C18H21F3N2O2S2 — CID 17034207
6-(5-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[2-(trifluoromethyl)phenyl]hexanamide (PubChem CID 17034207) has the molecular formula C18H21F3N2O2S2 and a molecular weight of 418.51 g/mol. Its IUPAC name is 6-(5-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[2-(trifluoromethyl)phenyl]hexanamide.
| Compound Name | 6-(5-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[2-(trifluoromethyl)phenyl]hexanamide |
|---|---|
| PubChem CID | 17034207 |
| Molecular Formula | C18H21F3N2O2S2 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 6-(5-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[2-(trifluoromethyl)phenyl]hexanamide |
| SMILES | CCC1SC(=S)N(CCCCCC(=O)Nc2ccccc2C(F)(F)F)C1=O |
| InChI | InChI=1S/C18H21F3N2O2S2/c1-2-14-16(25)23(17(26)27-14)11-7-3-4-10-15(24)22-13-9-6-5-8-12(13)18(19,20)21/h5-6,8-9,14H,2-4,7,10-11H2,1H3,(H,22,24) |
| InChIKey | IPTIXKYCHFAZKB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|