C20H20N2O3S — CID 17474007
4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(3-phenoxyphenyl)butanamide (PubChem CID 17474007) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(3-phenoxyphenyl)butanamide.
| Compound Name | 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(3-phenoxyphenyl)butanamide |
|---|---|
| PubChem CID | 17474007 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(3-phenoxyphenyl)butanamide |
| SMILES | Cc1csc(=O)n1CCCC(=O)Nc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C20H20N2O3S/c1-15-14-26-20(24)22(15)12-6-11-19(23)21-16-7-5-10-18(13-16)25-17-8-3-2-4-9-17/h2-5,7-10,13-14H,6,11-12H2,1H3,(H,21,23) |
| InChIKey | DTDQWCLDIKLXPW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |