C20H16N2O2S — CID 86917550
2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(2-phenylethynyl)phenyl]acetamide (PubChem CID 86917550) has the molecular formula C20H16N2O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(2-phenylethynyl)phenyl]acetamide.
| Compound Name | 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(2-phenylethynyl)phenyl]acetamide |
|---|---|
| PubChem CID | 86917550 |
| Molecular Formula | C20H16N2O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(2-phenylethynyl)phenyl]acetamide |
| SMILES | Cc1csc(=O)n1CC(=O)Nc1cccc(C#Cc2ccccc2)c1 |
| InChI | InChI=1S/C20H16N2O2S/c1-15-14-25-20(24)22(15)13-19(23)21-18-9-5-8-17(12-18)11-10-16-6-3-2-4-7-16/h2-9,12,14H,13H2,1H3,(H,21,23) |
| InChIKey | WQSQJXPAMNPSRL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|