C12H10FN3O4S — CID 27667264
N-(4-fluoro-3-nitrophenyl)-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide (PubChem CID 27667264) has the molecular formula C12H10FN3O4S and a molecular weight of 311.29 g/mol. Its IUPAC name is N-(4-fluoro-3-nitrophenyl)-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide.
| Compound Name | N-(4-fluoro-3-nitrophenyl)-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 27667264 |
| Molecular Formula | C12H10FN3O4S |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | N-(4-fluoro-3-nitrophenyl)-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide |
| SMILES | Cc1csc(=O)n1CC(=O)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H10FN3O4S/c1-7-6-21-12(18)15(7)5-11(17)14-8-2-3-9(13)10(4-8)16(19)20/h2-4,6H,5H2,1H3,(H,14,17) |
| InChIKey | JSNKMIBWONGNOJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 94.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|