C11H11FN6O3 — CID 115459155
2-[4-(aminomethyl)triazol-1-yl]-N-(4-fluoro-3-nitrophenyl)acetamide (PubChem CID 115459155) has the molecular formula C11H11FN6O3 and a molecular weight of 294.25 g/mol. Its IUPAC name is 2-[4-(aminomethyl)triazol-1-yl]-N-(4-fluoro-3-nitrophenyl)acetamide.
| Compound Name | 2-[4-(aminomethyl)triazol-1-yl]-N-(4-fluoro-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 115459155 |
| Molecular Formula | C11H11FN6O3 |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-[4-(aminomethyl)triazol-1-yl]-N-(4-fluoro-3-nitrophenyl)acetamide |
| SMILES | NCc1cn(CC(=O)Nc2ccc(F)c([N+](=O)[O-])c2)nn1 |
| InChI | InChI=1S/C11H11FN6O3/c12-9-2-1-7(3-10(9)18(20)21)14-11(19)6-17-5-8(4-13)15-16-17/h1-3,5H,4,6,13H2,(H,14,19) |
| InChIKey | KKMJJWXAMNOGTB-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|