C11H9F4N5O — CID 107641680
2-[4-(aminomethyl)triazol-1-yl]-N-(2,3,5,6-tetrafluorophenyl)acetamide (PubChem CID 107641680) has the molecular formula C11H9F4N5O and a molecular weight of 303.22 g/mol. Its IUPAC name is 2-[4-(aminomethyl)triazol-1-yl]-N-(2,3,5,6-tetrafluorophenyl)acetamide.
| Compound Name | 2-[4-(aminomethyl)triazol-1-yl]-N-(2,3,5,6-tetrafluorophenyl)acetamide |
|---|---|
| PubChem CID | 107641680 |
| Molecular Formula | C11H9F4N5O |
| Molecular Weight | 303.22 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-[4-(aminomethyl)triazol-1-yl]-N-(2,3,5,6-tetrafluorophenyl)acetamide |
| SMILES | NCc1cn(CC(=O)Nc2c(F)c(F)cc(F)c2F)nn1 |
| InChI | InChI=1S/C11H9F4N5O/c12-6-1-7(13)10(15)11(9(6)14)17-8(21)4-20-3-5(2-16)18-19-20/h1,3H,2,4,16H2,(H,17,21) |
| InChIKey | QRLIPMMTYOLZGE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.22 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|