C11H10Cl3N5O — CID 62054464
2-[4-(aminomethyl)triazol-1-yl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 62054464) has the molecular formula C11H10Cl3N5O and a molecular weight of 334.59 g/mol. Its IUPAC name is 2-[4-(aminomethyl)triazol-1-yl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[4-(aminomethyl)triazol-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 62054464 |
| Molecular Formula | C11H10Cl3N5O |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 2-[4-(aminomethyl)triazol-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | NCc1cn(CC(=O)Nc2cc(Cl)c(Cl)cc2Cl)nn1 |
| InChI | InChI=1S/C11H10Cl3N5O/c12-7-1-9(14)10(2-8(7)13)16-11(20)5-19-4-6(3-15)17-18-19/h1-2,4H,3,5,15H2,(H,16,20) |
| InChIKey | SUFBKYGXCXQCQV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|