C12H12F3N5O — CID 116642027
2-[4-(2-aminoethyl)triazol-1-yl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 116642027) has the molecular formula C12H12F3N5O and a molecular weight of 299.26 g/mol. Its IUPAC name is 2-[4-(2-aminoethyl)triazol-1-yl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[4-(2-aminoethyl)triazol-1-yl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 116642027 |
| Molecular Formula | C12H12F3N5O |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 2-[4-(2-aminoethyl)triazol-1-yl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | NCCc1cn(CC(=O)Nc2ccc(F)c(F)c2F)nn1 |
| InChI | InChI=1S/C12H12F3N5O/c13-8-1-2-9(12(15)11(8)14)17-10(21)6-20-5-7(3-4-16)18-19-20/h1-2,5H,3-4,6,16H2,(H,17,21) |
| InChIKey | MLUVOSXJFFHRIW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|