C12H12BrFN4O2 — CID 62401150
N-(4-bromo-2-fluorophenyl)-2-[4-(2-hydroxyethyl)triazol-1-yl]acetamide (PubChem CID 62401150) has the molecular formula C12H12BrFN4O2 and a molecular weight of 343.16 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-2-[4-(2-hydroxyethyl)triazol-1-yl]acetamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-2-[4-(2-hydroxyethyl)triazol-1-yl]acetamide |
|---|---|
| PubChem CID | 62401150 |
| Molecular Formula | C12H12BrFN4O2 |
| Molecular Weight | 343.16 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-2-[4-(2-hydroxyethyl)triazol-1-yl]acetamide |
| SMILES | O=C(Cn1cc(CCO)nn1)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C12H12BrFN4O2/c13-8-1-2-11(10(14)5-8)15-12(20)7-18-6-9(3-4-19)16-17-18/h1-2,5-6,19H,3-4,7H2,(H,15,20) |
| InChIKey | ZUHALJWADIUBAM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.16 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |