C13H11N7O — CID 107790636
2-[4-(aminomethyl)triazol-1-yl]-N-(3,4-dicyanophenyl)acetamide (PubChem CID 107790636) has the molecular formula C13H11N7O and a molecular weight of 281.28 g/mol. Its IUPAC name is 2-[4-(aminomethyl)triazol-1-yl]-N-(3,4-dicyanophenyl)acetamide.
| Compound Name | 2-[4-(aminomethyl)triazol-1-yl]-N-(3,4-dicyanophenyl)acetamide |
|---|---|
| PubChem CID | 107790636 |
| Molecular Formula | C13H11N7O |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-[4-(aminomethyl)triazol-1-yl]-N-(3,4-dicyanophenyl)acetamide |
| SMILES | N#Cc1ccc(NC(=O)Cn2cc(CN)nn2)cc1C#N |
| InChI | InChI=1S/C13H11N7O/c14-4-9-1-2-11(3-10(9)5-15)17-13(21)8-20-7-12(6-16)18-19-20/h1-3,7H,6,8,16H2,(H,17,21) |
| InChIKey | FJVONPHUGQLLKP-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |