C13H13N3O3S — CID 9192131
4-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]benzamide (PubChem CID 9192131) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is 4-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]benzamide.
| Compound Name | 4-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 9192131 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 4-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]benzamide |
| SMILES | Cc1csc(=O)n1CC(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C13H13N3O3S/c1-8-7-20-13(19)16(8)6-11(17)15-10-4-2-9(3-5-10)12(14)18/h2-5,7H,6H2,1H3,(H2,14,18)(H,15,17) |
| InChIKey | VLALLESLKKSRCT-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |