C6H8N2OS2 — CID 43287094
2-(4-methyl-2-oxo-1,3-thiazol-3-yl)ethanethioamide (PubChem CID 43287094) has the molecular formula C6H8N2OS2 and a molecular weight of 188.28 g/mol. Its IUPAC name is 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)ethanethioamide.
| Compound Name | 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)ethanethioamide |
|---|---|
| PubChem CID | 43287094 |
| Molecular Formula | C6H8N2OS2 |
| Molecular Weight | 188.28 g/mol |
| Exact Mass | 188.01 |
| IUPAC Name | 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)ethanethioamide |
| SMILES | Cc1csc(=O)n1CC(N)=S |
| InChI | InChI=1S/C6H8N2OS2/c1-4-3-11-6(9)8(4)2-5(7)10/h3H,2H2,1H3,(H2,7,10) |
| InChIKey | QEZYDPQFODZCDM-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|