C17H22N2O3S — CID 17429509
3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(4-phenoxybutyl)propanamide (PubChem CID 17429509) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(4-phenoxybutyl)propanamide.
| Compound Name | 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(4-phenoxybutyl)propanamide |
|---|---|
| PubChem CID | 17429509 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(4-phenoxybutyl)propanamide |
| SMILES | Cc1csc(=O)n1CCC(=O)NCCCCOc1ccccc1 |
| InChI | InChI=1S/C17H22N2O3S/c1-14-13-23-17(21)19(14)11-9-16(20)18-10-5-6-12-22-15-7-3-2-4-8-15/h2-4,7-8,13H,5-6,9-12H2,1H3,(H,18,20) |
| InChIKey | FRGXIXHSWLINIS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|