C11H16N2O4S — CID 119352737
4-[3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoylamino]butanoic acid (PubChem CID 119352737) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is 4-[3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoylamino]butanoic acid.
| Compound Name | 4-[3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 119352737 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 4-[3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoylamino]butanoic acid |
| SMILES | Cc1csc(=O)n1CCC(=O)NCCCC(=O)O |
| InChI | InChI=1S/C11H16N2O4S/c1-8-7-18-11(17)13(8)6-4-9(14)12-5-2-3-10(15)16/h7H,2-6H2,1H3,(H,12,14)(H,15,16) |
| InChIKey | ZESFKVNYAWDSFF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|