C15H18N2O2S2 — CID 27164511
3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(2-phenylsulfanylethyl)propanamide (PubChem CID 27164511) has the molecular formula C15H18N2O2S2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(2-phenylsulfanylethyl)propanamide.
| Compound Name | 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(2-phenylsulfanylethyl)propanamide |
|---|---|
| PubChem CID | 27164511 |
| Molecular Formula | C15H18N2O2S2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(2-phenylsulfanylethyl)propanamide |
| SMILES | Cc1csc(=O)n1CCC(=O)NCCSc1ccccc1 |
| InChI | InChI=1S/C15H18N2O2S2/c1-12-11-21-15(19)17(12)9-7-14(18)16-8-10-20-13-5-3-2-4-6-13/h2-6,11H,7-10H2,1H3,(H,16,18) |
| InChIKey | UAXBVMGMAGRYKY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|