C21H23N3O4 — CID 17414955
3-(2,4-dioxoquinazolin-1-yl)-N-(4-phenoxybutyl)propanamide (PubChem CID 17414955) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 3-(2,4-dioxoquinazolin-1-yl)-N-(4-phenoxybutyl)propanamide.
| Compound Name | 3-(2,4-dioxoquinazolin-1-yl)-N-(4-phenoxybutyl)propanamide |
|---|---|
| PubChem CID | 17414955 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 3-(2,4-dioxoquinazolin-1-yl)-N-(4-phenoxybutyl)propanamide |
| SMILES | O=C(CCn1c(=O)[nH]c(=O)c2ccccc21)NCCCCOc1ccccc1 |
| InChI | InChI=1S/C21H23N3O4/c25-19(22-13-6-7-15-28-16-8-2-1-3-9-16)12-14-24-18-11-5-4-10-17(18)20(26)23-21(24)27/h1-5,8-11H,6-7,12-15H2,(H,22,25)(H,23,26,27) |
| InChIKey | KJGSCXHRDHBZJE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|