C23H25N3O3 — CID 42408672
3-(2,4-dioxoquinazolin-1-yl)-N-[(1-phenylcyclopentyl)methyl]propanamide (PubChem CID 42408672) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 3-(2,4-dioxoquinazolin-1-yl)-N-[(1-phenylcyclopentyl)methyl]propanamide.
| Compound Name | 3-(2,4-dioxoquinazolin-1-yl)-N-[(1-phenylcyclopentyl)methyl]propanamide |
|---|---|
| PubChem CID | 42408672 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 3-(2,4-dioxoquinazolin-1-yl)-N-[(1-phenylcyclopentyl)methyl]propanamide |
| SMILES | O=C(CCn1c(=O)[nH]c(=O)c2ccccc21)NCC1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C23H25N3O3/c27-20(24-16-23(13-6-7-14-23)17-8-2-1-3-9-17)12-15-26-19-11-5-4-10-18(19)21(28)25-22(26)29/h1-5,8-11H,6-7,12-16H2,(H,24,27)(H,25,28,29) |
| InChIKey | LDMNVYSPEZJWOJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |