C24H21N3O3 — CID 18104755
N-benzhydryl-3-(2,4-dioxoquinazolin-1-yl)propanamide (PubChem CID 18104755) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is N-benzhydryl-3-(2,4-dioxoquinazolin-1-yl)propanamide.
| Compound Name | N-benzhydryl-3-(2,4-dioxoquinazolin-1-yl)propanamide |
|---|---|
| PubChem CID | 18104755 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N-benzhydryl-3-(2,4-dioxoquinazolin-1-yl)propanamide |
| SMILES | O=C(CCn1c(=O)[nH]c(=O)c2ccccc21)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H21N3O3/c28-21(15-16-27-20-14-8-7-13-19(20)23(29)26-24(27)30)25-22(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-14,22H,15-16H2,(H,25,28)(H,26,29,30) |
| InChIKey | UCAHNNNISADFCF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |