C15H17N3O5 — CID 119223783
2-[3-(2,4-dioxoquinazolin-1-yl)propanoylamino]butanoic acid (PubChem CID 119223783) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is 2-[3-(2,4-dioxoquinazolin-1-yl)propanoylamino]butanoic acid.
| Compound Name | 2-[3-(2,4-dioxoquinazolin-1-yl)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 119223783 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-[3-(2,4-dioxoquinazolin-1-yl)propanoylamino]butanoic acid |
| SMILES | CCC(NC(=O)CCn1c(=O)[nH]c(=O)c2ccccc21)C(=O)O |
| InChI | InChI=1S/C15H17N3O5/c1-2-10(14(21)22)16-12(19)7-8-18-11-6-4-3-5-9(11)13(20)17-15(18)23/h3-6,10H,2,7-8H2,1H3,(H,16,19)(H,21,22)(H,17,20,23) |
| InChIKey | VTYGUCAIOFEGQL-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |