C23H25N3O5 — CID 46662323
propan-2-yl 3-[3-(2,4-dioxoquinazolin-1-yl)propanoylamino]-3-phenylpropanoate (PubChem CID 46662323) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is propan-2-yl 3-[3-(2,4-dioxoquinazolin-1-yl)propanoylamino]-3-phenylpropanoate.
| Compound Name | propan-2-yl 3-[3-(2,4-dioxoquinazolin-1-yl)propanoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 46662323 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | propan-2-yl 3-[3-(2,4-dioxoquinazolin-1-yl)propanoylamino]-3-phenylpropanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)CCn1c(=O)[nH]c(=O)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C23H25N3O5/c1-15(2)31-21(28)14-18(16-8-4-3-5-9-16)24-20(27)12-13-26-19-11-7-6-10-17(19)22(29)25-23(26)30/h3-11,15,18H,12-14H2,1-2H3,(H,24,27)(H,25,29,30) |
| InChIKey | IJCYKHSULIWNMH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |