C18H23N3O3 — CID 94194144
propan-2-yl (3S)-3-phenyl-3-(3-pyrazol-1-ylpropanoylamino)propanoate (PubChem CID 94194144) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is propan-2-yl (3S)-3-phenyl-3-(3-pyrazol-1-ylpropanoylamino)propanoate.
| Compound Name | propan-2-yl (3S)-3-phenyl-3-(3-pyrazol-1-ylpropanoylamino)propanoate |
|---|---|
| PubChem CID | 94194144 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | propan-2-yl (3S)-3-phenyl-3-(3-pyrazol-1-ylpropanoylamino)propanoate |
| SMILES | CC(C)OC(=O)C[C@H](NC(=O)CCn1cccn1)c1ccccc1 |
| InChI | InChI=1S/C18H23N3O3/c1-14(2)24-18(23)13-16(15-7-4-3-5-8-15)20-17(22)9-12-21-11-6-10-19-21/h3-8,10-11,14,16H,9,12-13H2,1-2H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | PARCBCJLKSIMLO-INIZCTEOSA-N |
| XLogP | 2.47 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |