C19H26N4O4 — CID 60513440
4-[3-(2,4-dioxoquinazolin-1-yl)propanoylamino]-N,N-diethylbutanamide (PubChem CID 60513440) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 4-[3-(2,4-dioxoquinazolin-1-yl)propanoylamino]-N,N-diethylbutanamide.
| Compound Name | 4-[3-(2,4-dioxoquinazolin-1-yl)propanoylamino]-N,N-diethylbutanamide |
|---|---|
| PubChem CID | 60513440 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 4-[3-(2,4-dioxoquinazolin-1-yl)propanoylamino]-N,N-diethylbutanamide |
| SMILES | CCN(CC)C(=O)CCCNC(=O)CCn1c(=O)[nH]c(=O)c2ccccc21 |
| InChI | InChI=1S/C19H26N4O4/c1-3-22(4-2)17(25)10-7-12-20-16(24)11-13-23-15-9-6-5-8-14(15)18(26)21-19(23)27/h5-6,8-9H,3-4,7,10-13H2,1-2H3,(H,20,24)(H,21,26,27) |
| InChIKey | DQDZUCLHCRVQBE-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|