C26H25N3O4 — CID 55847244
3-(2,4-dioxoquinazolin-1-yl)-N-[2-(4-phenylmethoxyphenyl)ethyl]propanamide (PubChem CID 55847244) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is 3-(2,4-dioxoquinazolin-1-yl)-N-[2-(4-phenylmethoxyphenyl)ethyl]propanamide.
| Compound Name | 3-(2,4-dioxoquinazolin-1-yl)-N-[2-(4-phenylmethoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 55847244 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 3-(2,4-dioxoquinazolin-1-yl)-N-[2-(4-phenylmethoxyphenyl)ethyl]propanamide |
| SMILES | O=C(CCn1c(=O)[nH]c(=O)c2ccccc21)NCCc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H25N3O4/c30-24(15-17-29-23-9-5-4-8-22(23)25(31)28-26(29)32)27-16-14-19-10-12-21(13-11-19)33-18-20-6-2-1-3-7-20/h1-13H,14-18H2,(H,27,30)(H,28,31,32) |
| InChIKey | ANHZKUOUSZJSHE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |