C25H21ClN4O5 — CID 27259647
4-[(4-chlorophenoxy)methyl]-N'-[3-(2,4-dioxoquinazolin-1-yl)propanoyl]benzohydrazide (PubChem CID 27259647) has the molecular formula C25H21ClN4O5 and a molecular weight of 492.92 g/mol. Its IUPAC name is 4-[(4-chlorophenoxy)methyl]-N'-[3-(2,4-dioxoquinazolin-1-yl)propanoyl]benzohydrazide.
| Compound Name | 4-[(4-chlorophenoxy)methyl]-N'-[3-(2,4-dioxoquinazolin-1-yl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 27259647 |
| Molecular Formula | C25H21ClN4O5 |
| Molecular Weight | 492.92 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 4-[(4-chlorophenoxy)methyl]-N'-[3-(2,4-dioxoquinazolin-1-yl)propanoyl]benzohydrazide |
| SMILES | O=C(CCn1c(=O)[nH]c(=O)c2ccccc21)NNC(=O)c1ccc(COc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H21ClN4O5/c26-18-9-11-19(12-10-18)35-15-16-5-7-17(8-6-16)23(32)29-28-22(31)13-14-30-21-4-2-1-3-20(21)24(33)27-25(30)34/h1-12H,13-15H2,(H,28,31)(H,29,32)(H,27,33,34) |
| InChIKey | HEUPQBWSSSTNQQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.92 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|