C23H25ClN4O5 — CID 24514091
4-[(4-chlorophenoxy)methyl]-N'-[4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoyl]benzohydrazide (PubChem CID 24514091) has the molecular formula C23H25ClN4O5 and a molecular weight of 472.93 g/mol. Its IUPAC name is 4-[(4-chlorophenoxy)methyl]-N'-[4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoyl]benzohydrazide.
| Compound Name | 4-[(4-chlorophenoxy)methyl]-N'-[4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoyl]benzohydrazide |
|---|---|
| PubChem CID | 24514091 |
| Molecular Formula | C23H25ClN4O5 |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 4-[(4-chlorophenoxy)methyl]-N'-[4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoyl]benzohydrazide |
| SMILES | CC1(C)NC(=O)N(CCCC(=O)NNC(=O)c2ccc(COc3ccc(Cl)cc3)cc2)C1=O |
| InChI | InChI=1S/C23H25ClN4O5/c1-23(2)21(31)28(22(32)25-23)13-3-4-19(29)26-27-20(30)16-7-5-15(6-8-16)14-33-18-11-9-17(24)10-12-18/h5-12H,3-4,13-14H2,1-2H3,(H,25,32)(H,26,29)(H,27,30) |
| InChIKey | KMOFDWVGUKSVEU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|