C17H17ClN4O5 — CID 9273581
5-chloro-N'-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoyl]-1-benzofuran-2-carbohydrazide (PubChem CID 9273581) has the molecular formula C17H17ClN4O5 and a molecular weight of 392.80 g/mol. Its IUPAC name is 5-chloro-N'-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoyl]-1-benzofuran-2-carbohydrazide.
| Compound Name | 5-chloro-N'-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoyl]-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 9273581 |
| Molecular Formula | C17H17ClN4O5 |
| Molecular Weight | 392.80 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 5-chloro-N'-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoyl]-1-benzofuran-2-carbohydrazide |
| SMILES | CC1(C)NC(=O)N(CCC(=O)NNC(=O)c2cc3cc(Cl)ccc3o2)C1=O |
| InChI | InChI=1S/C17H17ClN4O5/c1-17(2)15(25)22(16(26)19-17)6-5-13(23)20-21-14(24)12-8-9-7-10(18)3-4-11(9)27-12/h3-4,7-8H,5-6H2,1-2H3,(H,19,26)(H,20,23)(H,21,24) |
| InChIKey | ZYXNAXQAOPNYJG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.80 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|