C18H12ClN3O4 — CID 9323491
5-chloro-N'-[2-(4-cyanophenoxy)acetyl]-1-benzofuran-2-carbohydrazide (PubChem CID 9323491) has the molecular formula C18H12ClN3O4 and a molecular weight of 369.76 g/mol. Its IUPAC name is 5-chloro-N'-[2-(4-cyanophenoxy)acetyl]-1-benzofuran-2-carbohydrazide.
| Compound Name | 5-chloro-N'-[2-(4-cyanophenoxy)acetyl]-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 9323491 |
| Molecular Formula | C18H12ClN3O4 |
| Molecular Weight | 369.76 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 5-chloro-N'-[2-(4-cyanophenoxy)acetyl]-1-benzofuran-2-carbohydrazide |
| SMILES | N#Cc1ccc(OCC(=O)NNC(=O)c2cc3cc(Cl)ccc3o2)cc1 |
| InChI | InChI=1S/C18H12ClN3O4/c19-13-3-6-15-12(7-13)8-16(26-15)18(24)22-21-17(23)10-25-14-4-1-11(9-20)2-5-14/h1-8H,10H2,(H,21,23)(H,22,24) |
| InChIKey | ICXGOFKHLACYHI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.76 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|