C15H11ClFN3O4S — CID 8614364
N'-(4-chloro-2-fluorophenyl)sulfonyl-2-(4-cyanophenoxy)acetohydrazide (PubChem CID 8614364) has the molecular formula C15H11ClFN3O4S and a molecular weight of 383.79 g/mol. Its IUPAC name is N'-(4-chloro-2-fluorophenyl)sulfonyl-2-(4-cyanophenoxy)acetohydrazide.
| Compound Name | N'-(4-chloro-2-fluorophenyl)sulfonyl-2-(4-cyanophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 8614364 |
| Molecular Formula | C15H11ClFN3O4S |
| Molecular Weight | 383.79 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | N'-(4-chloro-2-fluorophenyl)sulfonyl-2-(4-cyanophenoxy)acetohydrazide |
| SMILES | N#Cc1ccc(OCC(=O)NNS(=O)(=O)c2ccc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C15H11ClFN3O4S/c16-11-3-6-14(13(17)7-11)25(22,23)20-19-15(21)9-24-12-4-1-10(8-18)2-5-12/h1-7,20H,9H2,(H,19,21) |
| InChIKey | ZPVCCMFVPSNZNL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.79 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|