C17H23N5O3S — CID 9053941
1-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoylamino]-3-(2-phenylethyl)thiourea (PubChem CID 9053941) has the molecular formula C17H23N5O3S and a molecular weight of 377.47 g/mol. Its IUPAC name is 1-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoylamino]-3-(2-phenylethyl)thiourea.
| Compound Name | 1-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoylamino]-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 9053941 |
| Molecular Formula | C17H23N5O3S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 1-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoylamino]-3-(2-phenylethyl)thiourea |
| SMILES | CC1(C)NC(=O)N(CCC(=O)NNC(=S)NCCc2ccccc2)C1=O |
| InChI | InChI=1S/C17H23N5O3S/c1-17(2)14(24)22(16(25)19-17)11-9-13(23)20-21-15(26)18-10-8-12-6-4-3-5-7-12/h3-7H,8-11H2,1-2H3,(H,19,25)(H,20,23)(H2,18,21,26) |
| InChIKey | JEVGYCINXVYYCS-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|