C19H24N4O3S — CID 7977710
1-[3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-3-benzylthiourea (PubChem CID 7977710) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is 1-[3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-3-benzylthiourea.
| Compound Name | 1-[3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-3-benzylthiourea |
|---|---|
| PubChem CID | 7977710 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 1-[3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-3-benzylthiourea |
| SMILES | O=C(CCN1C(=O)[C@@H]2CCCC[C@H]2C1=O)NNC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C19H24N4O3S/c24-16(21-22-19(27)20-12-13-6-2-1-3-7-13)10-11-23-17(25)14-8-4-5-9-15(14)18(23)26/h1-3,6-7,14-15H,4-5,8-12H2,(H,21,24)(H2,20,22,27)/t14-,15-/m1/s1 |
| InChIKey | LQYRCHDWYLFIPZ-HUUCEWRRSA-N |
| XLogP | 1.25 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|