C29H28N2O5 — CID 51515702
[3-(benzylcarbamoyl)naphthalen-2-yl] 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate (PubChem CID 51515702) has the molecular formula C29H28N2O5 and a molecular weight of 484.55 g/mol. Its IUPAC name is [3-(benzylcarbamoyl)naphthalen-2-yl] 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate.
| Compound Name | [3-(benzylcarbamoyl)naphthalen-2-yl] 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 51515702 |
| Molecular Formula | C29H28N2O5 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | [3-(benzylcarbamoyl)naphthalen-2-yl] 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
| SMILES | O=C(CCN1C(=O)[C@@H]2CCCC[C@H]2C1=O)Oc1cc2ccccc2cc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C29H28N2O5/c32-26(14-15-31-28(34)22-12-6-7-13-23(22)29(31)35)36-25-17-21-11-5-4-10-20(21)16-24(25)27(33)30-18-19-8-2-1-3-9-19/h1-5,8-11,16-17,22-23H,6-7,12-15,18H2,(H,30,33)/t22-,23-/m1/s1 |
| InChIKey | ZGNKMJINLIWWHM-DHIUTWEWSA-N |
| XLogP | 4.24 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|