C16H18F2N4O4S — CID 9273561
N'-[2-(2,5-difluorophenyl)sulfanylacetyl]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanehydrazide (PubChem CID 9273561) has the molecular formula C16H18F2N4O4S and a molecular weight of 400.41 g/mol. Its IUPAC name is N'-[2-(2,5-difluorophenyl)sulfanylacetyl]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanehydrazide.
| Compound Name | N'-[2-(2,5-difluorophenyl)sulfanylacetyl]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 9273561 |
| Molecular Formula | C16H18F2N4O4S |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | N'-[2-(2,5-difluorophenyl)sulfanylacetyl]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanehydrazide |
| SMILES | CC1(C)NC(=O)N(CCC(=O)NNC(=O)CSc2cc(F)ccc2F)C1=O |
| InChI | InChI=1S/C16H18F2N4O4S/c1-16(2)14(25)22(15(26)19-16)6-5-12(23)20-21-13(24)8-27-11-7-9(17)3-4-10(11)18/h3-4,7H,5-6,8H2,1-2H3,(H,19,26)(H,20,23)(H,21,24) |
| InChIKey | USFISZMJHHTTTN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|