C17H16ClN3O3S — CID 47058183
N-[2-(5-chlorothiophen-2-yl)ethyl]-3-(2,4-dioxoquinazolin-1-yl)propanamide (PubChem CID 47058183) has the molecular formula C17H16ClN3O3S and a molecular weight of 377.85 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)ethyl]-3-(2,4-dioxoquinazolin-1-yl)propanamide.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-3-(2,4-dioxoquinazolin-1-yl)propanamide |
|---|---|
| PubChem CID | 47058183 |
| Molecular Formula | C17H16ClN3O3S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-3-(2,4-dioxoquinazolin-1-yl)propanamide |
| SMILES | O=C(CCn1c(=O)[nH]c(=O)c2ccccc21)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C17H16ClN3O3S/c18-14-6-5-11(25-14)7-9-19-15(22)8-10-21-13-4-2-1-3-12(13)16(23)20-17(21)24/h1-6H,7-10H2,(H,19,22)(H,20,23,24) |
| InChIKey | FLABXAGRCGIUNQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |