C25H16ClN3O2S — CID 135822120
1-(4-chlorophenyl)-6-hydroxy-5-[(E)-(2-phenylindol-3-ylidene)methyl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 135822120) has the molecular formula C25H16ClN3O2S and a molecular weight of 457.94 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6-hydroxy-5-[(E)-(2-phenylindol-3-ylidene)methyl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-(4-chlorophenyl)-6-hydroxy-5-[(E)-(2-phenylindol-3-ylidene)methyl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 135822120 |
| Molecular Formula | C25H16ClN3O2S |
| Molecular Weight | 457.94 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | 1-(4-chlorophenyl)-6-hydroxy-5-[(E)-(2-phenylindol-3-ylidene)methyl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)n(-c2ccc(Cl)cc2)c(O)c1/C=C1/C(c2ccccc2)=Nc2ccccc21 |
| InChI | InChI=1S/C25H16ClN3O2S/c26-16-10-12-17(13-11-16)29-24(31)20(23(30)28-25(29)32)14-19-18-8-4-5-9-21(18)27-22(19)15-6-2-1-3-7-15/h1-14,31H,(H,28,30,32)/b19-14+ |
| InChIKey | XFCLVMVOWWHKJA-XMHGGMMESA-N |
| XLogP | 5.93 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.94 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|