C24H17ClN2O2S — CID 91020063
1-(4-chlorophenyl)-5-(2,2-diphenylethenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one (PubChem CID 91020063) has the molecular formula C24H17ClN2O2S and a molecular weight of 432.93 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-(2,2-diphenylethenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-(4-chlorophenyl)-5-(2,2-diphenylethenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 91020063 |
| Molecular Formula | C24H17ClN2O2S |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 1-(4-chlorophenyl)-5-(2,2-diphenylethenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)n(-c2ccc(Cl)cc2)c(O)c1C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H17ClN2O2S/c25-18-11-13-19(14-12-18)27-23(29)21(22(28)26-24(27)30)15-20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-15,29H,(H,26,28,30) |
| InChIKey | JMEKZAUQOCZRIE-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|