C18H13ClN4O3S — CID 135420801
N-[(E)-[1-(3-chlorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]benzamide (PubChem CID 135420801) has the molecular formula C18H13ClN4O3S and a molecular weight of 400.85 g/mol. Its IUPAC name is N-[(E)-[1-(3-chlorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]benzamide.
| Compound Name | N-[(E)-[1-(3-chlorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 135420801 |
| Molecular Formula | C18H13ClN4O3S |
| Molecular Weight | 400.85 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | N-[(E)-[1-(3-chlorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1c(O)n(-c2cccc(Cl)c2)c(=S)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C18H13ClN4O3S/c19-12-7-4-8-13(9-12)23-17(26)14(16(25)21-18(23)27)10-20-22-15(24)11-5-2-1-3-6-11/h1-10,26H,(H,22,24)(H,21,25,27)/b20-10+ |
| InChIKey | MABJMXZSQJAMES-KEBDBYFISA-N |
| XLogP | 3.02 |
| TPSA | 99.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.85 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|