C23H17N5O3S — CID 135420822
N-[(E)-(4-hydroxy-6-oxo-1,3-diphenyl-2-sulfanylidenepyrimidin-5-yl)methylideneamino]pyridine-4-carboxamide (PubChem CID 135420822) has the molecular formula C23H17N5O3S and a molecular weight of 443.49 g/mol. Its IUPAC name is N-[(E)-(4-hydroxy-6-oxo-1,3-diphenyl-2-sulfanylidenepyrimidin-5-yl)methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-(4-hydroxy-6-oxo-1,3-diphenyl-2-sulfanylidenepyrimidin-5-yl)methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 135420822 |
| Molecular Formula | C23H17N5O3S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | N-[(E)-(4-hydroxy-6-oxo-1,3-diphenyl-2-sulfanylidenepyrimidin-5-yl)methylideneamino]pyridine-4-carboxamide |
| SMILES | O=C(N/N=C/c1c(O)n(-c2ccccc2)c(=S)n(-c2ccccc2)c1=O)c1ccncc1 |
| InChI | InChI=1S/C23H17N5O3S/c29-20(16-11-13-24-14-12-16)26-25-15-19-21(30)27(17-7-3-1-4-8-17)23(32)28(22(19)31)18-9-5-2-6-10-18/h1-15,30H,(H,26,29)/b25-15+ |
| InChIKey | HJBJJTXAXLCPII-MFKUBSTISA-N |
| XLogP | 3.22 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|