C26H22N4O6S — CID 135650693
2-hydroxy-N-[(Z)-[4-hydroxy-1,3-bis(2-methoxyphenyl)-6-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]benzamide (PubChem CID 135650693) has the molecular formula C26H22N4O6S and a molecular weight of 518.55 g/mol. Its IUPAC name is 2-hydroxy-N-[(Z)-[4-hydroxy-1,3-bis(2-methoxyphenyl)-6-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]benzamide.
| Compound Name | 2-hydroxy-N-[(Z)-[4-hydroxy-1,3-bis(2-methoxyphenyl)-6-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 135650693 |
| Molecular Formula | C26H22N4O6S |
| Molecular Weight | 518.55 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | 2-hydroxy-N-[(Z)-[4-hydroxy-1,3-bis(2-methoxyphenyl)-6-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]benzamide |
| SMILES | COc1ccccc1-n1c(O)c(/C=N\NC(=O)c2ccccc2O)c(=O)n(-c2ccccc2OC)c1=S |
| InChI | InChI=1S/C26H22N4O6S/c1-35-21-13-7-4-10-18(21)29-24(33)17(15-27-28-23(32)16-9-3-6-12-20(16)31)25(34)30(26(29)37)19-11-5-8-14-22(19)36-2/h3-15,31,33H,1-2H3,(H,28,32)/b27-15- |
| InChIKey | KVGQAOLEUKGRRY-DICXZTSXSA-N |
| XLogP | 3.55 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|