C14H14N4O3S — CID 135432776
N-[(E)-(4-hydroxy-1,3-dimethyl-6-oxo-2-sulfanylidenepyrimidin-5-yl)methylideneamino]benzamide (PubChem CID 135432776) has the molecular formula C14H14N4O3S and a molecular weight of 318.36 g/mol. Its IUPAC name is N-[(E)-(4-hydroxy-1,3-dimethyl-6-oxo-2-sulfanylidenepyrimidin-5-yl)methylideneamino]benzamide.
| Compound Name | N-[(E)-(4-hydroxy-1,3-dimethyl-6-oxo-2-sulfanylidenepyrimidin-5-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 135432776 |
| Molecular Formula | C14H14N4O3S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-[(E)-(4-hydroxy-1,3-dimethyl-6-oxo-2-sulfanylidenepyrimidin-5-yl)methylideneamino]benzamide |
| SMILES | Cn1c(O)c(/C=N/NC(=O)c2ccccc2)c(=O)n(C)c1=S |
| InChI | InChI=1S/C14H14N4O3S/c1-17-12(20)10(13(21)18(2)14(17)22)8-15-16-11(19)9-6-4-3-5-7-9/h3-8,20H,1-2H3,(H,16,19)/b15-8+ |
| InChIKey | VATGDBHNTZAYTF-OVCLIPMQSA-N |
| XLogP | 0.92 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|