C18H18N4O2 — CID 135987298
N-[(E)-[2-[(3E)-hexa-1,3,5-trien-3-yl]-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]benzamide (PubChem CID 135987298) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is N-[(E)-[2-[(3E)-hexa-1,3,5-trien-3-yl]-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]benzamide.
| Compound Name | N-[(E)-[2-[(3E)-hexa-1,3,5-trien-3-yl]-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 135987298 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | N-[(E)-[2-[(3E)-hexa-1,3,5-trien-3-yl]-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]benzamide |
| SMILES | C=C/C=C(\C=C)n1[nH]c(C)c(/C=N/NC(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C18H18N4O2/c1-4-9-15(5-2)22-18(24)16(13(3)21-22)12-19-20-17(23)14-10-7-6-8-11-14/h4-12,21H,1-2H2,3H3,(H,20,23)/b15-9+,19-12+ |
| InChIKey | DNNSBNQJGXQWGC-UUAZFVJBSA-N |
| XLogP | 2.46 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|