C18H13Cl3N4O2 — CID 137302245
N-[(Z)-[5-methyl-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-4-yl]methylideneamino]benzamide (PubChem CID 137302245) has the molecular formula C18H13Cl3N4O2 and a molecular weight of 423.69 g/mol. Its IUPAC name is N-[(Z)-[5-methyl-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-4-yl]methylideneamino]benzamide.
| Compound Name | N-[(Z)-[5-methyl-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-4-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 137302245 |
| Molecular Formula | C18H13Cl3N4O2 |
| Molecular Weight | 423.69 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | N-[(Z)-[5-methyl-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-4-yl]methylideneamino]benzamide |
| SMILES | Cc1[nH]n(-c2c(Cl)cc(Cl)cc2Cl)c(=O)c1/C=N\NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H13Cl3N4O2/c1-10-13(9-22-23-17(26)11-5-3-2-4-6-11)18(27)25(24-10)16-14(20)7-12(19)8-15(16)21/h2-9,24H,1H3,(H,23,26)/b22-9- |
| InChIKey | YCQKHJVGEJOJJV-AFPJDJCSSA-N |
| XLogP | 4.20 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.69 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|