C19H14Cl3N3O3 — CID 135619732
4-methyl-3-[[5-methyl-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-4-yl]methylideneamino]benzoic acid (PubChem CID 135619732) has the molecular formula C19H14Cl3N3O3 and a molecular weight of 438.70 g/mol. Its IUPAC name is 4-methyl-3-[[5-methyl-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-4-yl]methylideneamino]benzoic acid.
| Compound Name | 4-methyl-3-[[5-methyl-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-4-yl]methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 135619732 |
| Molecular Formula | C19H14Cl3N3O3 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | 4-methyl-3-[[5-methyl-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-4-yl]methylideneamino]benzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1/N=C/c1c(C)[nH]n(-c2c(Cl)cc(Cl)cc2Cl)c1=O |
| InChI | InChI=1S/C19H14Cl3N3O3/c1-9-3-4-11(19(27)28)5-16(9)23-8-13-10(2)24-25(18(13)26)17-14(21)6-12(20)7-15(17)22/h3-8,24H,1-2H3,(H,27,28)/b23-8+ |
| InChIKey | FNNVZZONQMVINW-LIMNOBDPSA-N |
| XLogP | 5.19 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|