C19H17N3O3 — CID 170524683
2-methyl-6-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]benzoic acid (PubChem CID 170524683) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-methyl-6-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]benzoic acid.
| Compound Name | 2-methyl-6-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 170524683 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 2-methyl-6-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]benzoic acid |
| SMILES | Cc1cccc(/N=C/c2c(C)[nH]n(-c3ccccc3)c2=O)c1C(=O)O |
| InChI | InChI=1S/C19H17N3O3/c1-12-7-6-10-16(17(12)19(24)25)20-11-15-13(2)21-22(18(15)23)14-8-4-3-5-9-14/h3-11,21H,1-2H3,(H,24,25)/b20-11+ |
| InChIKey | JWNMUKKJLVICBR-RGVLZGJSSA-N |
| XLogP | 3.23 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|