C24H19N3O3 — CID 170525097
2-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]-5-phenylbenzoic acid (PubChem CID 170525097) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is 2-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]-5-phenylbenzoic acid.
| Compound Name | 2-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]-5-phenylbenzoic acid |
|---|---|
| PubChem CID | 170525097 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 2-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]-5-phenylbenzoic acid |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1/C=N/c1ccc(-c2ccccc2)cc1C(=O)O |
| InChI | InChI=1S/C24H19N3O3/c1-16-21(23(28)27(26-16)19-10-6-3-7-11-19)15-25-22-13-12-18(14-20(22)24(29)30)17-8-4-2-5-9-17/h2-15,26H,1H3,(H,29,30)/b25-15+ |
| InChIKey | JMOLUKQJJWQHLW-MFKUBSTISA-N |
| XLogP | 4.59 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|