C25H21N3O3 — CID 170524942
3,5-dimethyl-2-[(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)methylideneamino]benzoic acid (PubChem CID 170524942) has the molecular formula C25H21N3O3 and a molecular weight of 411.46 g/mol. Its IUPAC name is 3,5-dimethyl-2-[(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)methylideneamino]benzoic acid.
| Compound Name | 3,5-dimethyl-2-[(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 170524942 |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 3,5-dimethyl-2-[(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)methylideneamino]benzoic acid |
| SMILES | Cc1cc(C)c(/N=C/c2c(-c3ccccc3)[nH]n(-c3ccccc3)c2=O)c(C(=O)O)c1 |
| InChI | InChI=1S/C25H21N3O3/c1-16-13-17(2)22(20(14-16)25(30)31)26-15-21-23(18-9-5-3-6-10-18)27-28(24(21)29)19-11-7-4-8-12-19/h3-15,27H,1-2H3,(H,30,31)/b26-15+ |
| InChIKey | FCXULYQMBZRLDB-CVKSISIWSA-N |
| XLogP | 4.90 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|