C40H38CoN6O6 — CID 170524981
cobalt;bis(2-[(5-hydroxy-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-3,5-dimethylbenzoic acid) (PubChem CID 170524981) has the molecular formula C40H38CoN6O6 and a molecular weight of 757.71 g/mol. Its IUPAC name is cobalt;bis(2-[(5-hydroxy-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-3,5-dimethylbenzoic acid).
| Compound Name | cobalt;bis(2-[(5-hydroxy-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-3,5-dimethylbenzoic acid) |
|---|---|
| PubChem CID | 170524981 |
| Molecular Formula | C40H38CoN6O6 |
| Molecular Weight | 757.71 g/mol |
| Exact Mass | 757.22 |
| IUPAC Name | cobalt;bis(2-[(5-hydroxy-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-3,5-dimethylbenzoic acid) |
| SMILES | Cc1cc(C)c(/N=C/c2c(C)nn(-c3ccccc3)c2O)c(C(=O)O)c1.Cc1cc(C)c(/N=C\c2c(C)nn(-c3ccccc3)c2O)c(C(=O)O)c1.[Co] |
| InChI | InChI=1S/2C20H19N3O3.Co/c2*1-12-9-13(2)18(16(10-12)20(25)26)21-11-17-14(3)22-23(19(17)24)15-7-5-4-6-8-15;/h2*4-11,24H,1-3H3,(H,25,26);/b21-11+;21-11-; |
| InChIKey | SADGHHMPOWTKDV-FFKWXNDSSA-N |
| XLogP | 7.90 |
| TPSA | 175.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.71 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_5_pyrazole_OH(14)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|