C19H16ClN3O2 — CID 170524797
3-chloro-2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]benzoic acid (PubChem CID 170524797) has the molecular formula C19H16ClN3O2 and a molecular weight of 353.81 g/mol. Its IUPAC name is 3-chloro-2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]benzoic acid.
| Compound Name | 3-chloro-2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 170524797 |
| Molecular Formula | C19H16ClN3O2 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 3-chloro-2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]benzoic acid |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=N/c1c(Cl)cccc1C(=O)O |
| InChI | InChI=1S/C19H16ClN3O2/c1-12-16(13(2)23(22-12)14-7-4-3-5-8-14)11-21-18-15(19(24)25)9-6-10-17(18)20/h3-11H,1-2H3,(H,24,25)/b21-11+ |
| InChIKey | ZYJYUWIGJUFYDT-SRZZPIQSSA-N |
| XLogP | 4.59 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|