C48H38CoN6O6 — CID 170524656
cobalt;bis(2-[[5-hydroxy-1-(4-methylphenyl)-3-phenylpyrazol-4-yl]methylideneamino]benzoic acid) (PubChem CID 170524656) has the molecular formula C48H38CoN6O6 and a molecular weight of 853.80 g/mol. Its IUPAC name is cobalt;bis(2-[[5-hydroxy-1-(4-methylphenyl)-3-phenylpyrazol-4-yl]methylideneamino]benzoic acid).
| Compound Name | cobalt;bis(2-[[5-hydroxy-1-(4-methylphenyl)-3-phenylpyrazol-4-yl]methylideneamino]benzoic acid) |
|---|---|
| PubChem CID | 170524656 |
| Molecular Formula | C48H38CoN6O6 |
| Molecular Weight | 853.80 g/mol |
| Exact Mass | 853.22 |
| IUPAC Name | cobalt;bis(2-[[5-hydroxy-1-(4-methylphenyl)-3-phenylpyrazol-4-yl]methylideneamino]benzoic acid) |
| SMILES | Cc1ccc(-n2nc(-c3ccccc3)c(/C=N/c3ccccc3C(=O)O)c2O)cc1.Cc1ccc(-n2nc(-c3ccccc3)c(/C=N\c3ccccc3C(=O)O)c2O)cc1.[Co] |
| InChI | InChI=1S/2C24H19N3O3.Co/c2*1-16-11-13-18(14-12-16)27-23(28)20(22(26-27)17-7-3-2-4-8-17)15-25-21-10-6-5-9-19(21)24(29)30;/h2*2-15,28H,1H3,(H,29,30);/b25-15+;25-15-; |
| InChIKey | KDRVOAMJMSRNGZ-JHESVPBSSA-N |
| XLogP | 10.00 |
| TPSA | 175.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.80 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|