C46H38CoN6O4 — CID 170525159
cobalt;bis(4-[(2-hydroxyphenyl)iminomethyl]-1-(3-methylphenyl)-3-phenylpyrazol-5-ol) (PubChem CID 170525159) has the molecular formula C46H38CoN6O4 and a molecular weight of 797.78 g/mol. Its IUPAC name is cobalt;bis(4-[(2-hydroxyphenyl)iminomethyl]-1-(3-methylphenyl)-3-phenylpyrazol-5-ol).
| Compound Name | cobalt;bis(4-[(2-hydroxyphenyl)iminomethyl]-1-(3-methylphenyl)-3-phenylpyrazol-5-ol) |
|---|---|
| PubChem CID | 170525159 |
| Molecular Formula | C46H38CoN6O4 |
| Molecular Weight | 797.78 g/mol |
| Exact Mass | 797.23 |
| IUPAC Name | cobalt;bis(4-[(2-hydroxyphenyl)iminomethyl]-1-(3-methylphenyl)-3-phenylpyrazol-5-ol) |
| SMILES | Cc1cccc(-n2nc(-c3ccccc3)c(/C=N\c3ccccc3O)c2O)c1.Cc1cccc(-n2nc(-c3ccccc3)c(/C=N\c3ccccc3O)c2O)c1.[Co] |
| InChI | InChI=1S/2C23H19N3O2.Co/c2*1-16-8-7-11-18(14-16)26-23(28)19(15-24-20-12-5-6-13-21(20)27)22(25-26)17-9-3-2-4-10-17;/h2*2-15,27-28H,1H3;/b2*24-15-; |
| InChIKey | BOPRBUJLUVHIQO-OLRZRQAMSA-N |
| XLogP | 10.02 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.78 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|