C32H22CoN10O12 — CID 170525154
cobalt;4-[(2-hydroxy-3,5-dinitrophenyl)iminomethyl]-3-nitro-1-phenylpyrazol-5-ol;4-[(2-hydroxyphenyl)iminomethyl]-3-nitro-1-phenylpyrazol-5-ol (PubChem CID 170525154) has the molecular formula C32H22CoN10O12 and a molecular weight of 797.52 g/mol. Its IUPAC name is cobalt;4-[(2-hydroxy-3,5-dinitrophenyl)iminomethyl]-3-nitro-1-phenylpyrazol-5-ol;4-[(2-hydroxyphenyl)iminomethyl]-3-nitro-1-phenylpyrazol-5-ol.
| Compound Name | cobalt;4-[(2-hydroxy-3,5-dinitrophenyl)iminomethyl]-3-nitro-1-phenylpyrazol-5-ol;4-[(2-hydroxyphenyl)iminomethyl]-3-nitro-1-phenylpyrazol-5-ol |
|---|---|
| PubChem CID | 170525154 |
| Molecular Formula | C32H22CoN10O12 |
| Molecular Weight | 797.52 g/mol |
| Exact Mass | 797.08 |
| IUPAC Name | cobalt;4-[(2-hydroxy-3,5-dinitrophenyl)iminomethyl]-3-nitro-1-phenylpyrazol-5-ol;4-[(2-hydroxyphenyl)iminomethyl]-3-nitro-1-phenylpyrazol-5-ol |
| SMILES | O=[N+]([O-])c1cc(/N=C\c2c([N+](=O)[O-])nn(-c3ccccc3)c2O)c(O)c([N+](=O)[O-])c1.O=[N+]([O-])c1nn(-c2ccccc2)c(O)c1/C=N\c1ccccc1O.[Co] |
| InChI | InChI=1S/C16H10N6O8.C16H12N4O4.Co/c23-14-12(6-10(20(25)26)7-13(14)21(27)28)17-8-11-15(22(29)30)18-19(16(11)24)9-4-2-1-3-5-9;21-14-9-5-4-8-13(14)17-10-12-15(20(23)24)18-19(16(12)22)11-6-2-1-3-7-11;/h1-8,23-24H;1-10,21-22H;/b17-8-;17-10-; |
| InChIKey | MMYWVGKJVHFIBX-WHKJPNDVSA-N |
| XLogP | 5.70 |
| TPSA | 313.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.52 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|